Target Relevance

Molecular Definition

Canonical SMILES COc1cccc(c1)c2n[nH]c(Cc3ccc4ccccc4c3)n2
Formula C20H17N3O
Molecular Weight 315.37 da
Stereocenters 0/0