Molecular Definition

Canonical SMILES COc1cc(ccc1Nc2ncc3N(C)C(=O)c4ccccc4N(C)c3n2)N5CCN(C)CC5
Formula C25H29N7O2
Molecular Weight 459.54 da
Stereocenters 0/0