Molecular Definition

Canonical SMILES CC(C)(C)Cc1c[nH]c(CC(C)(O)c2ccc(cc2)c3ccc(F)cn3)n1
Formula C22H26FN3O
Molecular Weight 367.46 da
Stereocenters 0/1