Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(cc1CC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)CSCc2ccccc2)C(=O)C
Formula C28H34N2O7S
Molecular Weight 542.64 da
Stereocenters 2/2