Molecular Definition

Canonical SMILES CN1CCN(Cc2cnc(nc2)c3oc4cnccc4c3Nc5ccc6c(O)cccc6c5)CC1
Formula C27H26N6O2
Molecular Weight 466.53 da
Stereocenters 0/0