Molecular Definition

Canonical SMILES O\N=C\1/NCc2cc(Nc3c(oc4cnccc34)c5ncccn5)ccc12
Formula C19H14N6O2
Molecular Weight 358.35 da
Stereocenters 0/0