Molecular Definition

Canonical SMILES COc1ccc(cn1)c2c(O)ccc3cc(ccc23)c4cccc(O)c4
Formula C22H17NO3
Molecular Weight 343.38 da
Stereocenters 0/0