Target Relevance

Molecular Definition

Canonical SMILES CN(C1CCN(CC1)C(=O)c2ccccc2)C(=O)c3cc4ccccc4cc3C(=O)C(c5cccc6ccccc56)P(=O)(O)O
Formula C36H33N2O6P
Molecular Weight 620.63 da
Stereocenters 0/1