Target Relevance

Molecular Definition

Canonical SMILES CCOC(=O)C1CCN(CC1)C(=O)CN2CN(c3ccccc3)C4(CCN(CC4)C(=O)c5ccc(cc5)C6CCCCC6)C2=O
Formula C36H46N4O5
Molecular Weight 614.77 da
Stereocenters 0/0