Target Relevance

Molecular Definition

Canonical SMILES CC(C)(C)OC(=O)N1CCN(CC1)C(=O)CN2CN(c3ccccc3)C4(CCN(CC4)C(=O)c5ccc(cc5)C(C)(C)C)C2=O
Formula C35H47N5O5
Molecular Weight 617.78 da
Stereocenters 0/0