Target Relevance

Molecular Definition

Canonical SMILES CC1(C)CC(CC(C)(C)N1)OC(=O)CN2CN(c3ccccc3)C4(CCN(CC4)C(=O)c5ccc(cc5)C6CCCCC6)C2=O
Formula C37H50N4O4
Molecular Weight 614.82 da
Stereocenters 0/0