Molecular Definition

Canonical SMILES COc1cc(ccc1O)C(=S)N2CCCCC2
Formula C13H17NO2S
Molecular Weight 251.35 da
Stereocenters 0/0