Molecular Definition

Canonical SMILES CN1CCN(CC1)C(=O)C2=C(N)N(C(=S)S2)c3ccc(C)cc3
Formula C16H20N4OS2
Molecular Weight 348.49 da
Stereocenters 0/0