Molecular Definition

Canonical SMILES Brc1cnc2c(c1)nc3S\C(=C/c4occc4)\C(=O)n23
Formula C13H6BrN3O2S
Molecular Weight 348.18 da
Stereocenters 0/0