Target Relevance

Molecular Definition

Canonical SMILES C(Cc1c[nH]c2ccc(cc12)n3cnnc3)N4CCC[C@@H]4COCc5ccccc5
Formula C24H27N5O
Molecular Weight 401.50 da
Stereocenters 1/1