Molecular Definition

Canonical SMILES O=C(NCCCCCCNC(=O)ON=C1CCCCC1)ON=C2CCCCC2
Formula C20H34N4O4
Molecular Weight 394.51 da
Stereocenters 0/0