Molecular Definition

Canonical SMILES CC(=O)NC(c1cccs1)c2cc(Br)c3cccnc3c2O
Formula C16H13BrN2O2S
Molecular Weight 377.26 da
Stereocenters 0/1