Molecular Definition

Canonical SMILES C(Nc1ncnc2ccc(cc12)c3ccc4OCOc4c3)C5CCCO5
Formula C20H19N3O3
Molecular Weight 349.38 da
Stereocenters 0/1