Target Relevance

Molecular Definition

Canonical SMILES CN(C1CCCCC1)C(=O)c2nn(c3ccc(Cl)cc3Cl)c(c2C)c4ccc(Cl)cc4
Formula C24H24Cl3N3O
Molecular Weight 476.83 da
Stereocenters 0/0