Target Relevance

Molecular Definition

Canonical SMILES CCCC(=O)NC(Cc1ccc(O)cc1)C(O)NCCCNCCCCCCCCN
Formula C24H44N4O3
Molecular Weight 436.63 da
Stereocenters 0/2