Molecular Definition

Canonical SMILES COc1ccc(cc1)S(=O)(=O)C(CC(=O)NO)Cc2ccccc2
Formula C17H19NO5S
Molecular Weight 349.40 da
Stereocenters 0/1