Target Relevance

Molecular Definition

Canonical SMILES CN1N=C(N=C2C(=O)N(C)C(=O)N=C12)c3ccccc3
Formula C13H11N5O2
Molecular Weight 269.26 da
Stereocenters 0/0