Molecular Definition

Canonical SMILES Fc1ccccc1NC(=O)CN2c3ccccc3C(=O)c4ccccc24
Formula C21H15FN2O2
Molecular Weight 346.35 da
Stereocenters 0/0