Molecular Definition

Canonical SMILES Oc1c(Br)cc(Br)cc1Oc2c(O)c(Br)c(Br)c(Br)c2Br
Formula C12H4Br6O3
Molecular Weight 675.58 da
Stereocenters 0/0