Molecular Definition

Canonical SMILES N[C@@H](COc1ccccc1)c2ccccc2
Formula C14H15NO
Molecular Weight 213.28 da
Stereocenters 1/1