Target Relevance

Molecular Definition

Canonical SMILES Cc1cccc(NC(=O)c2cc(c[nH]2)S(=O)(=O)N3CCCCC3)c1C
Formula C18H23N3O3S
Molecular Weight 361.46 da
Stereocenters 0/0