Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(NC(=O)Nc2ccc(\C=C\C(=O)NO)cc2)cc1OC
Formula C18H19N3O5
Molecular Weight 357.36 da
Stereocenters 0/0