Target Relevance

Molecular Definition

Canonical SMILES CC(C)c1cc(C(C)C)c(c(c1)C(C)C)S(=O)(=O)NC(Cc2cccc(c2)C(N)N)C(=O)N3CCN(CC3)C(=O)OCc4ccccc4
Formula C37H51N5O5S
Molecular Weight 677.90 da
Stereocenters 0/1