Target Relevance

Molecular Definition

Canonical SMILES Cc1cc(CNS(=O)(=O)c2ccc(O)c(c2)C(=O)O)sc1C(=O)N[C@@H](CC(=O)O)C(=O)CSCc3ccccc3Cl
Formula C26H25ClN2O9S3
Molecular Weight 641.13 da
Stereocenters 1/1