Target Relevance

Molecular Definition

Canonical SMILES C=CCNC(=S)NNC(=O)c1ccncc1
Formula C10H12N4OS
Molecular Weight 236.29 da
Stereocenters 0/0