Target Relevance

Molecular Definition

Canonical SMILES CCCC(=O)NC(Cc1ccc(O)cc1)C(=O)NCCCCCCCCNCCCN
Formula C24H42N4O3
Molecular Weight 434.62 da
Stereocenters 0/1