Molecular Definition

Canonical SMILES Cc1cc(Cl)cc(C)c1OC[C@@H](N)c2ccccc2
Formula C16H18ClNO
Molecular Weight 275.77 da
Stereocenters 1/1