Molecular Definition

Canonical SMILES Cc1c(CC(=O)N)c2c(OCCCC(=O)O)cccc2n1Cc3ccccc3
Formula C22H24N2O4
Molecular Weight 380.44 da
Stereocenters 0/0