Molecular Definition

Canonical SMILES NS(=O)(=O)c1cc(ccc1Cl)C(=O)NC2CCSc3ccccc23
Formula C16H15ClN2O3S2
Molecular Weight 382.89 da
Stereocenters 0/1