Target Relevance

Molecular Definition

Canonical SMILES CCCc1ccc(OCc2oc(cc2)C(=O)N3CCSCC3)cc1
Formula C19H23NO3S
Molecular Weight 345.46 da
Stereocenters 0/0