Molecular Definition

Canonical SMILES Cc1ccccc1Cn2nnc3C(=O)c4ccccc4C(=O)c23
Formula C18H13N3O2
Molecular Weight 303.31 da
Stereocenters 0/0