Molecular Definition

Canonical SMILES CN(CC(=O)Nc1ccc(C)cc1)C(=O)c2cccc(c2)n3cccc3
Formula C21H21N3O2
Molecular Weight 347.41 da
Stereocenters 0/0