Molecular Definition

Canonical SMILES COC(=O)C1=C(C)NC(=O)N(C1c2ccc3nonc3c2)C(=O)NCCCN4CCC(CC4)(C(=O)OC)c5ccccc5
Formula C30H34N6O7
Molecular Weight 590.63 da
Stereocenters 0/1