Molecular Definition

Canonical SMILES Fc1ccc(cc1)C(OCCN2CCNCC2)c3ccc(F)cc3
Formula C19H22F2N2O
Molecular Weight 332.39 da
Stereocenters 0/0