Molecular Definition

Canonical SMILES COC(=O)C1=C(C)NC(=O)N(C1c2ccc(cc2)[N+](=O)[O-])C(=O)NCCCN3CCC(CC3)(C(=O)OC)c4ccccc4
Formula C30H35N5O8
Molecular Weight 593.63 da
Stereocenters 0/1