Molecular Definition

Canonical SMILES CC(C)OC(=O)C1=C(C)N=C2SC(=Cc3ccc(OCC(=O)O)cc3)C(=O)N2C1c4ccc(Cl)cc4
Formula C26H23ClN2O6S
Molecular Weight 526.99 da
Stereocenters 0/1