Molecular Definition

Canonical SMILES Clc1cccc(Cl)c1NC(=S)NCCc2ccccc2
Formula C15H14Cl2N2S
Molecular Weight 325.26 da
Stereocenters 0/0