Molecular Definition

Canonical SMILES CCC(=O)NC(c1cccs1)c2cc(Cl)c3cccnc3c2O
Formula C17H15ClN2O2S
Molecular Weight 346.83 da
Stereocenters 0/1