Target Relevance

Molecular Definition

Canonical SMILES Cn1nnnc1Sc2ncnc3scc(c4ccc(N)cc4)c23
Formula C14H11N7S2
Molecular Weight 341.41 da
Stereocenters 0/0