Molecular Definition

Canonical SMILES CN(Cc1nccs1)c2ncnc3ccc(cc23)c4ccc5OCOc5c4
Formula C20H16N4O2S
Molecular Weight 376.43 da
Stereocenters 0/0