Molecular Definition

Canonical SMILES CC(=O)OC1C(=O)[C@@]2(C)C(O)CC3OC[C@]3(OC(=O)C)C2C(OC(=O)c4ccccc4)[C@]5(O)CC(OC(=O)C(O)C(NC(=O)c6ccccc6)c7ccccc7)C(=C1C5(C)C)C
Formula C47H51NO14
Molecular Weight 853.91 da
Stereocenters 3/11