Molecular Definition

Canonical SMILES CC1(C)CC(C)(c2ccccc2)c3cccc4\C(=C/5\SC(=S)NC5=O)\C(=O)N1c34
Formula C23H20N2O2S2
Molecular Weight 420.55 da
Stereocenters 0/1