Molecular Definition

Canonical SMILES CC(C)[C@@H]1N2C(=O)[C@](NC(=O)[C@H]3CN(C)[C@@H]4Cc5c[nH]c6cccc(C4=C3)c56)(O[C@@]2(O)[C@@H]7CCCN7C1=O)C(C)C
Formula C31H39N5O5
Molecular Weight 561.67 da
Stereocenters 6/6