Molecular Definition

Canonical SMILES CCC(=O)NC(c1cccs1)c2cc(c3cccnc3c2O)[N+](=O)[O-]
Formula C17H15N3O4S
Molecular Weight 357.38 da
Stereocenters 0/1