Molecular Definition

Canonical SMILES COC(=O)c1cccc(c1)N2Sc3ccccc3C2=O
Formula C15H11NO3S
Molecular Weight 285.32 da
Stereocenters 0/0